C26H26F2N4O2 — CID 25121714
5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-fluorophenyl)-2-methyl-N-[2-(propan-2-ylamino)ethyl]-1H-pyrrole-3-carboxamide (PubChem CID 25121714) has the molecular formula C26H26F2N4O2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-fluorophenyl)-2-methyl-N-[2-(propan-2-ylamino)ethyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-fluorophenyl)-2-methyl-N-[2-(propan-2-ylamino)ethyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 25121714 |
| Molecular Formula | C26H26F2N4O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-fluorophenyl)-2-methyl-N-[2-(propan-2-ylamino)ethyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(-c2ccc(F)cc2)c1C(=O)NCCNC(C)C |
| InChI | InChI=1S/C26H26F2N4O2/c1-14(2)29-10-11-30-26(34)23-15(3)31-22(24(23)16-4-6-17(27)7-5-16)13-20-19-12-18(28)8-9-21(19)32-25(20)33/h4-9,12-14,29,31H,10-11H2,1-3H3,(H,30,34)(H,32,33)/b20-13- |
| InChIKey | FQGBNFVZVWEMNC-MOSHPQCFSA-N |
| XLogP | 4.49 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|