C24H38O2 — CID 25121912
ethyl (5Z,8Z,11Z,14Z,17Z)-2,2-dimethylicosa-5,8,11,14,17-pentaenoate (PubChem CID 25121912) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is ethyl (5Z,8Z,11Z,14Z,17Z)-2,2-dimethylicosa-5,8,11,14,17-pentaenoate.
| Compound Name | ethyl (5Z,8Z,11Z,14Z,17Z)-2,2-dimethylicosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 25121912 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | ethyl (5Z,8Z,11Z,14Z,17Z)-2,2-dimethylicosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C24H38O2/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(3,4)23(25)26-6-2/h7-8,10-11,13-14,16-17,19-20H,5-6,9,12,15,18,21-22H2,1-4H3/b8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | FVJMJOSAOINYAJ-NEUKSRIFSA-N |
| XLogP | 7.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|