C23H36O3 — CID 25122278
ethyl (5Z,8Z,11Z,14Z,17Z)-2-methoxyicosa-5,8,11,14,17-pentaenoate (PubChem CID 25122278) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is ethyl (5Z,8Z,11Z,14Z,17Z)-2-methoxyicosa-5,8,11,14,17-pentaenoate.
| Compound Name | ethyl (5Z,8Z,11Z,14Z,17Z)-2-methoxyicosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 25122278 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | ethyl (5Z,8Z,11Z,14Z,17Z)-2-methoxyicosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(OC)C(=O)OCC |
| InChI | InChI=1S/C23H36O3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(25-3)23(24)26-5-2/h6-7,9-10,12-13,15-16,18-19,22H,4-5,8,11,14,17,20-21H2,1-3H3/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | CAWZWIWTWWLDCS-WMPRHZDHSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|