C24H28FN3O4 — CID 25122324
8-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 25122324) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is 8-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 25122324 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 8-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCOc1cc(CN2CCC3(CC2)NC(=O)NC3=O)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28FN3O4/c1-3-31-19-13-16(14-20(32-4-2)21(19)17-5-7-18(25)8-6-17)15-28-11-9-24(10-12-28)22(29)26-23(30)27-24/h5-8,13-14H,3-4,9-12,15H2,1-2H3,(H2,26,27,29,30) |
| InChIKey | WILOTRUGSQCRHL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|