C22H27FN6O3 — CID 25122608
4-[2-fluoro-5-[(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)methyl]benzoyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 25122608) has the molecular formula C22H27FN6O3 and a molecular weight of 442.50 g/mol. Its IUPAC name is 4-[2-fluoro-5-[(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)methyl]benzoyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[2-fluoro-5-[(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)methyl]benzoyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 25122608 |
| Molecular Formula | C22H27FN6O3 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-[2-fluoro-5-[(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)methyl]benzoyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4c3NCCC4)ccc2F)CC1 |
| InChI | InChI=1S/C22H27FN6O3/c1-27(2)22(32)29-10-8-28(9-11-29)21(31)16-12-14(5-6-17(16)23)13-18-19-15(4-3-7-24-19)20(30)26-25-18/h5-6,12,24H,3-4,7-11,13H2,1-2H3,(H,26,30) |
| InChIKey | KPICWBKXUKUCNP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |