C19H21F3N2O2 — CID 25123136
3-[4-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]cyclohexyl]propanoic acid (PubChem CID 25123136) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 3-[4-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]cyclohexyl]propanoic acid.
| Compound Name | 3-[4-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 25123136 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-[4-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]cyclohexyl]propanoic acid |
| SMILES | O=C(O)CCC1CCC(c2ccc(-c3cc(C(F)(F)F)[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C19H21F3N2O2/c20-19(21,22)17-11-16(23-24-17)15-8-6-14(7-9-15)13-4-1-12(2-5-13)3-10-18(25)26/h6-9,11-13H,1-5,10H2,(H,23,24)(H,25,26) |
| InChIKey | ZSAMVIXQLAFSNL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |