About morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone
morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone (PubChem CID 25123154) has the molecular formula C28H27N3O5
and a molecular weight of 485.54 g/mol. Its IUPAC name is morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone |
| PubChem CID | 25123154 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone |
| SMILES | COc1cc(-c2cnc3cccc(-c4ccc(C(=O)N5CCOCC5)cc4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C28H27N3O5/c1-33-24-15-20(16-25(34-2)27(24)35-3)23-17-29-22-6-4-5-21(26(22)30-23)18-7-9-19(10-8-18)28(32)31-11-13-36-14-12-31/h4-10,15-17H,11-14H2,1-3H3 |
| InChIKey | OULZBAGEWRZSEB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone?
The IUPAC name of morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone (CID 25123154) is morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone.
What is the SMILES notation for morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone?
The canonical SMILES for morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone is COc1cc(-c2cnc3cccc(-c4ccc(C(=O)N5CCOCC5)cc4)c3n2)cc(OC)c1OC.
What is the InChIKey of morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone?
The InChIKey is OULZBAGEWRZSEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O5/c1-33-24-15-20(16-25(34-2)27(24)35-3)23-17-29-22-6-4-5-21(26(22)30-23)18-7-9-19(10-8-18)28(32)31-11-13-36-14-12-31/h4-10,15-17H,11-14H2,1-3H3.
What are the key properties of morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone?
morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone has a molecular weight of 485.54 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methanone is sourced from PubChem (CID 25123154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).