C25H18N4O8S2 — CID 25123503
1-amino-9,10-dioxo-4-[4-(pyridin-4-ylamino)-3-sulfoanilino]anthracene-2-sulfonic acid (PubChem CID 25123503) has the molecular formula C25H18N4O8S2 and a molecular weight of 566.57 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-[4-(pyridin-4-ylamino)-3-sulfoanilino]anthracene-2-sulfonic acid.
| Compound Name | 1-amino-9,10-dioxo-4-[4-(pyridin-4-ylamino)-3-sulfoanilino]anthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 25123503 |
| Molecular Formula | C25H18N4O8S2 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 1-amino-9,10-dioxo-4-[4-(pyridin-4-ylamino)-3-sulfoanilino]anthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(Nc3ccncc3)c(S(=O)(=O)O)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H18N4O8S2/c26-23-20(39(35,36)37)12-18(21-22(23)25(31)16-4-2-1-3-15(16)24(21)30)29-14-5-6-17(19(11-14)38(32,33)34)28-13-7-9-27-10-8-13/h1-12,29H,26H2,(H,27,28)(H,32,33,34)(H,35,36,37) |
| InChIKey | BIPDBBZXMPZSPK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 205.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|