C22H29NO — CID 25123625
(8R,9S,10R,13S,14S,17R)-13-methyl-3-oxo-17-prop-2-enyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 25123625) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-13-methyl-3-oxo-17-prop-2-enyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9S,10R,13S,14S,17R)-13-methyl-3-oxo-17-prop-2-enyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 25123625 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-13-methyl-3-oxo-17-prop-2-enyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C=CC[C@]1(C#N)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H29NO/c1-3-10-22(14-23)12-9-20-19-6-4-15-13-16(24)5-7-17(15)18(19)8-11-21(20,22)2/h3,13,17-20H,1,4-12H2,2H3/t17-,18+,19+,20-,21-,22+/m0/s1 |
| InChIKey | PTBRJCVUEMRGCR-REGVOWLASA-N |
| XLogP | 5.21 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|