C17H20N4O4 — CID 25123662
2-amino-7-(3,4-dihydroxy-3-methylbut-1-ynyl)-1-ethyl-N-methyl-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 25123662) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-amino-7-(3,4-dihydroxy-3-methylbut-1-ynyl)-1-ethyl-N-methyl-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 2-amino-7-(3,4-dihydroxy-3-methylbut-1-ynyl)-1-ethyl-N-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 25123662 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-amino-7-(3,4-dihydroxy-3-methylbut-1-ynyl)-1-ethyl-N-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1c(N)c(C(=O)NC)c(=O)c2ccc(C#CC(C)(O)CO)nc21 |
| InChI | InChI=1S/C17H20N4O4/c1-4-21-14(18)12(16(24)19-3)13(23)11-6-5-10(20-15(11)21)7-8-17(2,25)9-22/h5-6,22,25H,4,9,18H2,1-3H3,(H,19,24) |
| InChIKey | MVWHUIXRJVHKNS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|