About methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate
methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate (PubChem CID 25123737) has the molecular formula C19H21N3O3
and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate.
Molecular Properties
| Compound Name | methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate |
| PubChem CID | 25123737 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1ncnc2oc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H21N3O3/c1-24-17(23)10-6-3-7-11-20-18-15-12-16(14-8-4-2-5-9-14)25-19(15)22-13-21-18/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3,(H,20,21,22) |
| InChIKey | ACKUCGHGNMQFJO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate?
The IUPAC name of methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate (CID 25123737) is methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate.
What is the SMILES notation for methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate?
The canonical SMILES for methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate is COC(=O)CCCCCNc1ncnc2oc(-c3ccccc3)cc12.
What is the InChIKey of methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate?
The InChIKey is ACKUCGHGNMQFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3/c1-24-17(23)10-6-3-7-11-20-18-15-12-16(14-8-4-2-5-9-14)25-19(15)22-13-21-18/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3,(H,20,21,22).
What are the key properties of methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate?
methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate has a molecular weight of 339.39 g/mol, XLogP of 4.04, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(6-phenylfuro[2,3-d]pyrimidin-4-yl)amino]hexanoate is sourced from PubChem (CID 25123737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).