About 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine
4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine (PubChem CID 25123808) has the molecular formula C29H31N3O4
and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine |
| PubChem CID | 25123808 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine |
| SMILES | COc1cc(-c2cnc3cccc(-c4ccc(CN5CCOCC5)c(C)c4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N3O4/c1-19-14-20(8-9-21(19)18-32-10-12-36-13-11-32)23-6-5-7-24-28(23)31-25(17-30-24)22-15-26(33-2)29(35-4)27(16-22)34-3/h5-9,14-17H,10-13,18H2,1-4H3 |
| InChIKey | GIEHCMJOLMYDLH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine?
The IUPAC name of 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine (CID 25123808) is 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine.
What is the SMILES notation for 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine?
The canonical SMILES for 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine is COc1cc(-c2cnc3cccc(-c4ccc(CN5CCOCC5)c(C)c4)c3n2)cc(OC)c1OC.
What is the InChIKey of 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine?
The InChIKey is GIEHCMJOLMYDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31N3O4/c1-19-14-20(8-9-21(19)18-32-10-12-36-13-11-32)23-6-5-7-24-28(23)31-25(17-30-24)22-15-26(33-2)29(35-4)27(16-22)34-3/h5-9,14-17H,10-13,18H2,1-4H3.
What are the key properties of 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine?
4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine has a molecular weight of 485.58 g/mol, XLogP of 5.13, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-methyl-4-[3-(3,4,5-trimethoxyphenyl)quinoxalin-5-yl]phenyl]methyl]morpholine is sourced from PubChem (CID 25123808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).