C29H25F2N3O5 — CID 25124054
1-[[4-[5-[4-[(2,3-difluorophenyl)methyl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid (PubChem CID 25124054) has the molecular formula C29H25F2N3O5 and a molecular weight of 533.53 g/mol. Its IUPAC name is 1-[[4-[5-[4-[(2,3-difluorophenyl)methyl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid.
| Compound Name | 1-[[4-[5-[4-[(2,3-difluorophenyl)methyl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid |
|---|---|
| PubChem CID | 25124054 |
| Molecular Formula | C29H25F2N3O5 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 1-[[4-[5-[4-[(2,3-difluorophenyl)methyl]phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4,4-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCN(Cc2ccc(-c3noc(-c4ccc(Cc5cccc(F)c5F)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H25F2N3O5/c30-23-3-1-2-22(24(23)31)16-18-4-10-21(11-5-18)26-32-25(33-39-26)20-8-6-19(7-9-20)17-34-14-12-29(13-15-34,27(35)36)28(37)38/h1-11H,12-17H2,(H,35,36)(H,37,38) |
| InChIKey | GLCREXZQMFQBIV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|