C30H38N6O3 — CID 25124078
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 25124078) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25124078 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyrimidin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2ncccn2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C30H38N6O3/c1-4-34-16-18-35(19-17-34)26-9-5-8-23-24(26)21-36(29(23)37)25(10-6-13-31-30-32-14-7-15-33-30)22-11-12-27(38-2)28(20-22)39-3/h5,7-9,11-12,14-15,20,25H,4,6,10,13,16-19,21H2,1-3H3,(H,31,32,33)/t25-/m1/s1 |
| InChIKey | HMQZNNGISOGOHO-RUZDIDTESA-N |
| XLogP | 4.23 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|