C23H20Cl3FN4O3 — CID 25124395
(Z)-3-chloro-1-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 25124395) has the molecular formula C23H20Cl3FN4O3 and a molecular weight of 525.80 g/mol. Its IUPAC name is (Z)-3-chloro-1-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-chloro-1-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 25124395 |
| Molecular Formula | C23H20Cl3FN4O3 |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | (Z)-3-chloro-1-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CCN(C(=O)/C=C\Cl)CC1 |
| InChI | InChI=1S/C23H20Cl3FN4O3/c1-33-18-11-17-14(10-19(18)34-13-5-8-31(9-6-13)20(32)4-7-24)23(29-12-28-17)30-16-3-2-15(25)21(26)22(16)27/h2-4,7,10-13H,5-6,8-9H2,1H3,(H,28,29,30)/b7-4- |
| InChIKey | KQDMOGZWSDSXSJ-DAXSKMNVSA-N |
| XLogP | 5.95 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|