C30H40N6O5S — CID 25124399
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[7-(4-ethylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]butyl]-1-methylimidazole-4-sulfonamide (PubChem CID 25124399) has the molecular formula C30H40N6O5S and a molecular weight of 596.75 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[7-(4-ethylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]butyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[7-(4-ethylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]butyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 25124399 |
| Molecular Formula | C30H40N6O5S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[7-(4-ethylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]butyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNS(=O)(=O)c2cn(C)cn2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C30H40N6O5S/c1-5-34-14-16-35(17-15-34)26-9-6-8-23-24(26)19-36(30(23)37)25(22-11-12-27(40-3)28(18-22)41-4)10-7-13-32-42(38,39)29-20-33(2)21-31-29/h6,8-9,11-12,18,20-21,25,32H,5,7,10,13-17,19H2,1-4H3/t25-/m1/s1 |
| InChIKey | DHLDIWPCSAZKLC-RUZDIDTESA-N |
| XLogP | 3.04 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|