C25H24Cl2FN5O4 — CID 25124727
N-[3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3-oxoprop-1-en-2-yl]acetamide (PubChem CID 25124727) has the molecular formula C25H24Cl2FN5O4 and a molecular weight of 548.40 g/mol. Its IUPAC name is N-[3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3-oxoprop-1-en-2-yl]acetamide.
| Compound Name | N-[3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3-oxoprop-1-en-2-yl]acetamide |
|---|---|
| PubChem CID | 25124727 |
| Molecular Formula | C25H24Cl2FN5O4 |
| Molecular Weight | 548.40 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | N-[3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3-oxoprop-1-en-2-yl]acetamide |
| SMILES | C=C(NC(C)=O)C(=O)N1CCC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C25H24Cl2FN5O4/c1-13(31-14(2)34)25(35)33-8-6-15(7-9-33)37-21-10-16-19(11-20(21)36-3)29-12-30-24(16)32-18-5-4-17(26)22(27)23(18)28/h4-5,10-12,15H,1,6-9H2,2-3H3,(H,31,34)(H,29,30,32) |
| InChIKey | YTFMBVGQRKBBSX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|