C17H20O9 — CID 25124927
1,3,4-trihydroxy-5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid (PubChem CID 25124927) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is 1,3,4-trihydroxy-5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | 1,3,4-trihydroxy-5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 25124927 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1,3,4-trihydroxy-5-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(/C=C/C(=O)OC2CC(O)(C(=O)O)CC(O)C2O)cc1O |
| InChI | InChI=1S/C17H20O9/c1-25-12-4-2-9(6-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+ |
| InChIKey | ZHBZPCLRULAFBL-HWKANZROSA-N |
| XLogP | -0.34 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|