About 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one
2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one (PubChem CID 25125131) has the molecular formula C21H22N6O2
and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one |
| PubChem CID | 25125131 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one |
| SMILES | COc1ccc(-n2[nH]c3c(cnc4ccc(N5CCN(C)CC5)nc43)c2=O)cc1 |
| InChI | InChI=1S/C21H22N6O2/c1-25-9-11-26(12-10-25)18-8-7-17-20(23-18)19-16(13-22-17)21(28)27(24-19)14-3-5-15(29-2)6-4-14/h3-8,13,24H,9-12H2,1-2H3 |
| InChIKey | ONKQUGDEKDTFHX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one?
The IUPAC name of 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one (CID 25125131) is 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one.
What is the SMILES notation for 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one?
The canonical SMILES for 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one is COc1ccc(-n2[nH]c3c(cnc4ccc(N5CCN(C)CC5)nc43)c2=O)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one?
The InChIKey is ONKQUGDEKDTFHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N6O2/c1-25-9-11-26(12-10-25)18-8-7-17-20(23-18)19-16(13-22-17)21(28)27(24-19)14-3-5-15(29-2)6-4-14/h3-8,13,24H,9-12H2,1-2H3.
What are the key properties of 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one?
2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one has a molecular weight of 390.45 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one is sourced from PubChem (CID 25125131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).