C21H22FN3O5 — CID 25125166
N-[(2S)-2,3-dihydroxypropoxy]-2-(4-ethynyl-2-fluoroanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide (PubChem CID 25125166) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropoxy]-2-(4-ethynyl-2-fluoroanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide.
| Compound Name | N-[(2S)-2,3-dihydroxypropoxy]-2-(4-ethynyl-2-fluoroanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide |
|---|---|
| PubChem CID | 25125166 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropoxy]-2-(4-ethynyl-2-fluoroanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide |
| SMILES | C#Cc1ccc(Nc2c(C(=O)NOC[C@@H](O)CO)c3c(n2C)C(=O)CCC3)c(F)c1 |
| InChI | InChI=1S/C21H22FN3O5/c1-3-12-7-8-16(15(22)9-12)23-20-18(21(29)24-30-11-13(27)10-26)14-5-4-6-17(28)19(14)25(20)2/h1,7-9,13,23,26-27H,4-6,10-11H2,2H3,(H,24,29)/t13-/m0/s1 |
| InChIKey | XDELWCVTFJFXQO-ZDUSSCGKSA-N |
| XLogP | 1.42 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|