About 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one
7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 25125300) has the molecular formula C23H23FN4O
and a molecular weight of 390.46 g/mol. Its IUPAC name is 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one.
Molecular Properties
| Compound Name | 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one |
| PubChem CID | 25125300 |
| Molecular Formula | C23H23FN4O |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | CC1CC(C)CN(c2cc3ncc4c(=O)n(-c5ccccc5)[nH]c4c3cc2F)C1 |
| InChI | InChI=1S/C23H23FN4O/c1-14-8-15(2)13-27(12-14)21-10-20-17(9-19(21)24)22-18(11-25-20)23(29)28(26-22)16-6-4-3-5-7-16/h3-7,9-11,14-15,26H,8,12-13H2,1-2H3 |
| InChIKey | DDSCKAVGDZIEBY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one?
The IUPAC name of 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one (CID 25125300) is 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one.
What is the SMILES notation for 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one?
The canonical SMILES for 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one is CC1CC(C)CN(c2cc3ncc4c(=O)n(-c5ccccc5)[nH]c4c3cc2F)C1.
What is the InChIKey of 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one?
The InChIKey is DDSCKAVGDZIEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN4O/c1-14-8-15(2)13-27(12-14)21-10-20-17(9-19(21)24)22-18(11-25-20)23(29)28(26-22)16-6-4-3-5-7-16/h3-7,9-11,14-15,26H,8,12-13H2,1-2H3.
What are the key properties of 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one?
7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one has a molecular weight of 390.46 g/mol, XLogP of 4.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,5-dimethylpiperidin-1-yl)-8-fluoro-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one is sourced from PubChem (CID 25125300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).