C28H30ClF2N5O4 — CID 25125419
1-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-2-(morpholin-4-ylmethyl)prop-2-en-1-one (PubChem CID 25125419) has the molecular formula C28H30ClF2N5O4 and a molecular weight of 574.03 g/mol. Its IUPAC name is 1-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-2-(morpholin-4-ylmethyl)prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-2-(morpholin-4-ylmethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 25125419 |
| Molecular Formula | C28H30ClF2N5O4 |
| Molecular Weight | 574.03 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 1-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-2-(morpholin-4-ylmethyl)prop-2-en-1-one |
| SMILES | C=C(CN1CCOCC1)C(=O)N1CCC(Oc2cc3c(Nc4ccc(F)c(Cl)c4F)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C28H30ClF2N5O4/c1-17(15-35-9-11-39-12-10-35)28(37)36-7-5-18(6-8-36)40-24-13-19-22(14-23(24)38-2)32-16-33-27(19)34-21-4-3-20(30)25(29)26(21)31/h3-4,13-14,16,18H,1,5-12,15H2,2H3,(H,32,33,34) |
| InChIKey | XSKUQYCJRLUUPM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|