C29H36F2N6O — CID 25126034
(2R)-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-(6-fluoro-3-pyridinyl)octan-1-ol (PubChem CID 25126034) has the molecular formula C29H36F2N6O and a molecular weight of 522.64 g/mol. Its IUPAC name is (2R)-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-(6-fluoro-3-pyridinyl)octan-1-ol.
| Compound Name | (2R)-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-(6-fluoro-3-pyridinyl)octan-1-ol |
|---|---|
| PubChem CID | 25126034 |
| Molecular Formula | C29H36F2N6O |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (2R)-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-(6-fluoro-3-pyridinyl)octan-1-ol |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3F)cc(N[C@@H](CO)CCCCCCc3ccc(F)nc3)nc12 |
| InChI | InChI=1S/C29H36F2N6O/c1-20(2)24-18-34-37-28(33-17-22-10-7-8-12-25(22)30)15-27(36-29(24)37)35-23(19-38)11-6-4-3-5-9-21-13-14-26(31)32-16-21/h7-8,10,12-16,18,20,23,33,38H,3-6,9,11,17,19H2,1-2H3,(H,35,36)/t23-/m1/s1 |
| InChIKey | GCVJWKBFTWIYMY-HSZRJFAPSA-N |
| XLogP | 6.10 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|