C22H23ClN2O4 — CID 2512619
[2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 2512619) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2512619 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)COC(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H23ClN2O4/c1-3-17-8-4-5-10-19(17)24-20(26)14-25(2)21(27)15-29-22(28)12-11-16-7-6-9-18(23)13-16/h4-13H,3,14-15H2,1-2H3,(H,24,26)/b12-11+ |
| InChIKey | USOOZMGUDARGHK-VAWYXSNFSA-N |
| XLogP | 3.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|