C31H39N5O3 — CID 25127077
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 25127077) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25127077 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2ccccn2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H39N5O3/c1-4-34-17-19-35(20-18-34)27-10-7-9-24-25(27)22-36(31(24)37)26(11-8-16-33-30-12-5-6-15-32-30)23-13-14-28(38-2)29(21-23)39-3/h5-7,9-10,12-15,21,26H,4,8,11,16-20,22H2,1-3H3,(H,32,33)/t26-/m1/s1 |
| InChIKey | VYVIRWJOJMPTLX-AREMUKBSSA-N |
| XLogP | 4.83 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|