C34H35FN4O6 — CID 25127374
4-[2-(butylamino)-2-oxoethoxy]carbonyl-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 25127374) has the molecular formula C34H35FN4O6 and a molecular weight of 614.67 g/mol. Its IUPAC name is 4-[2-(butylamino)-2-oxoethoxy]carbonyl-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[2-(butylamino)-2-oxoethoxy]carbonyl-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 25127374 |
| Molecular Formula | C34H35FN4O6 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 4-[2-(butylamino)-2-oxoethoxy]carbonyl-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | CCCCNC(=O)COC(=O)C1(C(=O)O)CCN(Cc2ccc(-c3noc(-c4ccc(-c5ccccc5)c(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C34H35FN4O6/c1-2-3-17-36-29(40)22-44-33(43)34(32(41)42)15-18-39(19-16-34)21-23-9-11-25(12-10-23)30-37-31(45-38-30)26-13-14-27(28(35)20-26)24-7-5-4-6-8-24/h4-14,20H,2-3,15-19,21-22H2,1H3,(H,36,40)(H,41,42) |
| InChIKey | AWPDQWZQQGMQMM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|