About 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid
2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid (PubChem CID 2512745) has the molecular formula C6H6N2O4
and a molecular weight of 170.12 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid |
| PubChem CID | 2512745 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C6H6N2O4/c9-4-1-2-7-6(12)8(4)3-5(10)11/h1-2H,3H2,(H,7,12)(H,10,11) |
| InChIKey | QFUOATLPSKJDGL-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
The IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid (CID 2512745) is 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid.
What is the SMILES notation for 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
The canonical SMILES for 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid is O=C(O)Cn1c(=O)cc[nH]c1=O.
What is the InChIKey of 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
The InChIKey is QFUOATLPSKJDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4/c9-4-1-2-7-6(12)8(4)3-5(10)11/h1-2H,3H2,(H,7,12)(H,10,11).
What are the key properties of 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid has a molecular weight of 170.12 g/mol, XLogP of -1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1H-pyrimidin-3-yl)acetic acid is sourced from PubChem (CID 2512745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).