About 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene
1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene (PubChem CID 25127628) has the molecular formula C20H26O6
and a molecular weight of 362.42 g/mol. Its IUPAC name is 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene.
Molecular Properties
| Compound Name | 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene |
| PubChem CID | 25127628 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene |
| SMILES | C#Cc1cc(OCCOCCOC)c(C#C)cc1OCCOCCOC |
| InChI | InChI=1S/C20H26O6/c1-5-17-15-20(26-14-12-24-10-8-22-4)18(6-2)16-19(17)25-13-11-23-9-7-21-3/h1-2,15-16H,7-14H2,3-4H3 |
| InChIKey | ZSZLCKZZVMHUOX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene?
The IUPAC name of 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene (CID 25127628) is 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene.
What is the SMILES notation for 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene?
The canonical SMILES for 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene is C#Cc1cc(OCCOCCOC)c(C#C)cc1OCCOCCOC.
What is the InChIKey of 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene?
The InChIKey is ZSZLCKZZVMHUOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O6/c1-5-17-15-20(26-14-12-24-10-8-22-4)18(6-2)16-19(17)25-13-11-23-9-7-21-3/h1-2,15-16H,7-14H2,3-4H3.
What are the key properties of 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene?
1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene has a molecular weight of 362.42 g/mol, XLogP of 1.73, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethynyl-2,5-bis[2-(2-methoxyethoxy)ethoxy]benzene is sourced from PubChem (CID 25127628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).