C17H15N3O3S2 — CID 25127785
2-[(5-methylsulfonyl-2-pyridinyl)amino]-5-phenylthiophene-3-carboxamide (PubChem CID 25127785) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[(5-methylsulfonyl-2-pyridinyl)amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[(5-methylsulfonyl-2-pyridinyl)amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 25127785 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-[(5-methylsulfonyl-2-pyridinyl)amino]-5-phenylthiophene-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2sc(-c3ccccc3)cc2C(N)=O)nc1 |
| InChI | InChI=1S/C17H15N3O3S2/c1-25(22,23)12-7-8-15(19-10-12)20-17-13(16(18)21)9-14(24-17)11-5-3-2-4-6-11/h2-10H,1H3,(H2,18,21)(H,19,20) |
| InChIKey | ALQAFKSRAQPQEL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |