C23H28O5S — CID 25127822
4-(4-methylsulfonylphenyl)-1-phenyl-4-propoxycyclohexane-1-carboxylic acid (PubChem CID 25127822) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-1-phenyl-4-propoxycyclohexane-1-carboxylic acid.
| Compound Name | 4-(4-methylsulfonylphenyl)-1-phenyl-4-propoxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 25127822 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-1-phenyl-4-propoxycyclohexane-1-carboxylic acid |
| SMILES | CCCOC1(c2ccc(S(C)(=O)=O)cc2)CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28O5S/c1-3-17-28-23(19-9-11-20(12-10-19)29(2,26)27)15-13-22(14-16-23,21(24)25)18-7-5-4-6-8-18/h4-12H,3,13-17H2,1-2H3,(H,24,25) |
| InChIKey | KCNGEOOAVITFNB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |