About (2S)-2,6-bis(carbamoylamino)hexanoic acid
(2S)-2,6-bis(carbamoylamino)hexanoic acid (PubChem CID 2512811) has the molecular formula C8H16N4O4
and a molecular weight of 232.24 g/mol. Its IUPAC name is (2S)-2,6-bis(carbamoylamino)hexanoic acid.
Molecular Properties
| Compound Name | (2S)-2,6-bis(carbamoylamino)hexanoic acid |
| PubChem CID | 2512811 |
| Molecular Formula | C8H16N4O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2S)-2,6-bis(carbamoylamino)hexanoic acid |
| SMILES | NC(=O)NCCCC[C@H](NC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H16N4O4/c9-7(15)11-4-2-1-3-5(6(13)14)12-8(10)16/h5H,1-4H2,(H,13,14)(H3,9,11,15)(H3,10,12,16)/t5-/m0/s1 |
| InChIKey | MIKBDBZLKXLZTM-YFKPBYRVSA-N |
| XLogP | -1.05 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-bis(carbamoylamino)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-bis(carbamoylamino)hexanoic acid?
The IUPAC name of (2S)-2,6-bis(carbamoylamino)hexanoic acid (CID 2512811) is (2S)-2,6-bis(carbamoylamino)hexanoic acid.
What is the SMILES notation for (2S)-2,6-bis(carbamoylamino)hexanoic acid?
The canonical SMILES for (2S)-2,6-bis(carbamoylamino)hexanoic acid is NC(=O)NCCCC[C@H](NC(N)=O)C(=O)O.
What is the InChIKey of (2S)-2,6-bis(carbamoylamino)hexanoic acid?
The InChIKey is MIKBDBZLKXLZTM-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H16N4O4/c9-7(15)11-4-2-1-3-5(6(13)14)12-8(10)16/h5H,1-4H2,(H,13,14)(H3,9,11,15)(H3,10,12,16)/t5-/m0/s1.
What are the key properties of (2S)-2,6-bis(carbamoylamino)hexanoic acid?
(2S)-2,6-bis(carbamoylamino)hexanoic acid has a molecular weight of 232.24 g/mol, XLogP of -1.05, 7 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-bis(carbamoylamino)hexanoic acid is sourced from PubChem (CID 2512811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).