About 4-(aminomethyl)benzamide
4-(aminomethyl)benzamide (PubChem CID 2512818) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-(aminomethyl)benzamide.
Molecular Properties
| Compound Name | 4-(aminomethyl)benzamide |
| PubChem CID | 2512818 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 4-(aminomethyl)benzamide |
| SMILES | NCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C8H10N2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H2,10,11) |
| InChIKey | JKIHDSIADUBKPU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)benzamide?
The IUPAC name of 4-(aminomethyl)benzamide (CID 2512818) is 4-(aminomethyl)benzamide.
What is the SMILES notation for 4-(aminomethyl)benzamide?
The canonical SMILES for 4-(aminomethyl)benzamide is NCc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-(aminomethyl)benzamide?
The InChIKey is JKIHDSIADUBKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H2,10,11).
What are the key properties of 4-(aminomethyl)benzamide?
4-(aminomethyl)benzamide has a molecular weight of 150.18 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)benzamide is sourced from PubChem (CID 2512818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).