About [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate
[2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2512828) has the molecular formula C14H16FNO5S
and a molecular weight of 329.35 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate |
| PubChem CID | 2512828 |
| Molecular Formula | C14H16FNO5S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccccc1F)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16FNO5S/c1-16(10-6-7-22(19,20)9-10)13(17)8-21-14(18)11-4-2-3-5-12(11)15/h2-5,10H,6-9H2,1H3/t10-/m1/s1 |
| InChIKey | CMWWPWBYFHSLAW-SNVBAGLBSA-N |
| XLogP | 0.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate?
The IUPAC name of [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate (CID 2512828) is [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate.
What is the SMILES notation for [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate?
The canonical SMILES for [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate is CN(C(=O)COC(=O)c1ccccc1F)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate?
The InChIKey is CMWWPWBYFHSLAW-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H16FNO5S/c1-16(10-6-7-22(19,20)9-10)13(17)8-21-14(18)11-4-2-3-5-12(11)15/h2-5,10H,6-9H2,1H3/t10-/m1/s1.
What are the key properties of [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate?
[2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate has a molecular weight of 329.35 g/mol, XLogP of 0.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2-fluorobenzoate is sourced from PubChem (CID 2512828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).