About methyl 2-azidosulfonylbenzoate
methyl 2-azidosulfonylbenzoate (PubChem CID 25128429) has the molecular formula C8H7N3O4S
and a molecular weight of 241.23 g/mol. Its IUPAC name is methyl 2-azidosulfonylbenzoate.
Molecular Properties
| Compound Name | methyl 2-azidosulfonylbenzoate |
| PubChem CID | 25128429 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | methyl 2-azidosulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H7N3O4S/c1-15-8(12)6-4-2-3-5-7(6)16(13,14)11-10-9/h2-5H,1H3 |
| InChIKey | JHCHSFDDSZQGIQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-azidosulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-azidosulfonylbenzoate?
The IUPAC name of methyl 2-azidosulfonylbenzoate (CID 25128429) is methyl 2-azidosulfonylbenzoate.
What is the SMILES notation for methyl 2-azidosulfonylbenzoate?
The canonical SMILES for methyl 2-azidosulfonylbenzoate is COC(=O)c1ccccc1S(=O)(=O)N=[N+]=[N-].
What is the InChIKey of methyl 2-azidosulfonylbenzoate?
The InChIKey is JHCHSFDDSZQGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O4S/c1-15-8(12)6-4-2-3-5-7(6)16(13,14)11-10-9/h2-5H,1H3.
What are the key properties of methyl 2-azidosulfonylbenzoate?
methyl 2-azidosulfonylbenzoate has a molecular weight of 241.23 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-azidosulfonylbenzoate is sourced from PubChem (CID 25128429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).