About tert-butyl cyclohex-2-en-1-yl carbonate
tert-butyl cyclohex-2-en-1-yl carbonate (PubChem CID 25128457) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is tert-butyl cyclohex-2-en-1-yl carbonate.
Molecular Properties
| Compound Name | tert-butyl cyclohex-2-en-1-yl carbonate |
| PubChem CID | 25128457 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | tert-butyl cyclohex-2-en-1-yl carbonate |
| SMILES | CC(C)(C)OC(=O)OC1C=CCCC1 |
| InChI | InChI=1S/C11H18O3/c1-11(2,3)14-10(12)13-9-7-5-4-6-8-9/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | OWTGXKHEHADFAK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl cyclohex-2-en-1-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl cyclohex-2-en-1-yl carbonate?
The IUPAC name of tert-butyl cyclohex-2-en-1-yl carbonate (CID 25128457) is tert-butyl cyclohex-2-en-1-yl carbonate.
What is the SMILES notation for tert-butyl cyclohex-2-en-1-yl carbonate?
The canonical SMILES for tert-butyl cyclohex-2-en-1-yl carbonate is CC(C)(C)OC(=O)OC1C=CCCC1.
What is the InChIKey of tert-butyl cyclohex-2-en-1-yl carbonate?
The InChIKey is OWTGXKHEHADFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-11(2,3)14-10(12)13-9-7-5-4-6-8-9/h5,7,9H,4,6,8H2,1-3H3.
What are the key properties of tert-butyl cyclohex-2-en-1-yl carbonate?
tert-butyl cyclohex-2-en-1-yl carbonate has a molecular weight of 198.26 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl cyclohex-2-en-1-yl carbonate is sourced from PubChem (CID 25128457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).