C23H31BrO7S3 — CID 25128501
(4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-4a-[tris(methylsulfanyl)methyl]-3,4-dihydro-2H-xanthen-1-one (PubChem CID 25128501) has the molecular formula C23H31BrO7S3 and a molecular weight of 595.60 g/mol. Its IUPAC name is (4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-4a-[tris(methylsulfanyl)methyl]-3,4-dihydro-2H-xanthen-1-one.
| Compound Name | (4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-4a-[tris(methylsulfanyl)methyl]-3,4-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 25128501 |
| Molecular Formula | C23H31BrO7S3 |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | (4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-4a-[tris(methylsulfanyl)methyl]-3,4-dihydro-2H-xanthen-1-one |
| SMILES | COCCOCO[C@H]1CCC(=O)C2=C(O)c3c(cc(C)c(Br)c3OC)O[C@]21C(SC)(SC)SC |
| InChI | InChI=1S/C23H31BrO7S3/c1-13-11-15-17(21(28-3)19(13)24)20(26)18-14(25)7-8-16(30-12-29-10-9-27-2)22(18,31-15)23(32-4,33-5)34-6/h11,16,26H,7-10,12H2,1-6H3/t16-,22-/m0/s1 |
| InChIKey | JQHWYGNZVZBXFT-AOMKIAJQSA-N |
| XLogP | 5.28 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|