About (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one
(E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 25128774) has the molecular formula C22H21NO6
and a molecular weight of 395.41 g/mol. Its IUPAC name is (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
| PubChem CID | 25128774 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | C=CCOc1cc(OC)c(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c(OCC=C)c1 |
| InChI | InChI=1S/C22H21NO6/c1-4-12-28-18-14-20(27-3)22(21(15-18)29-13-5-2)19(24)11-8-16-6-9-17(10-7-16)23(25)26/h4-11,14-15H,1-2,12-13H2,3H3/b11-8+ |
| InChIKey | LTNGZPSWCUHNHO-DHZHZOJOSA-N |
| XLogP | 4.63 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one?
The IUPAC name of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one (CID 25128774) is (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one?
The canonical SMILES for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one is C=CCOc1cc(OC)c(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c(OCC=C)c1.
What is the InChIKey of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one?
The InChIKey is LTNGZPSWCUHNHO-DHZHZOJOSA-N. The full InChI is InChI=1S/C22H21NO6/c1-4-12-28-18-14-20(27-3)22(21(15-18)29-13-5-2)19(24)11-8-16-6-9-17(10-7-16)23(25)26/h4-11,14-15H,1-2,12-13H2,3H3/b11-8+.
What are the key properties of (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one?
(E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one has a molecular weight of 395.41 g/mol, XLogP of 4.63, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[2-methoxy-4,6-bis(prop-2-enoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one is sourced from PubChem (CID 25128774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).