About 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine
4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine (PubChem CID 25128806) has the molecular formula C17H30N2S2
and a molecular weight of 326.58 g/mol. Its IUPAC name is 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine.
Molecular Properties
| Compound Name | 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine |
| PubChem CID | 25128806 |
| Molecular Formula | C17H30N2S2 |
| Molecular Weight | 326.58 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine |
| SMILES | CC(C)CCc1cc(SCC(C)C)nc(SCC(C)C)n1 |
| InChI | InChI=1S/C17H30N2S2/c1-12(2)7-8-15-9-16(20-10-13(3)4)19-17(18-15)21-11-14(5)6/h9,12-14H,7-8,10-11H2,1-6H3 |
| InChIKey | BDXDZFYHKUFHMK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine?
The IUPAC name of 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine (CID 25128806) is 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine.
What is the SMILES notation for 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine?
The canonical SMILES for 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine is CC(C)CCc1cc(SCC(C)C)nc(SCC(C)C)n1.
What is the InChIKey of 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine?
The InChIKey is BDXDZFYHKUFHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2S2/c1-12(2)7-8-15-9-16(20-10-13(3)4)19-17(18-15)21-11-14(5)6/h9,12-14H,7-8,10-11H2,1-6H3.
What are the key properties of 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine?
4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine has a molecular weight of 326.58 g/mol, XLogP of 5.56, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutyl)-2,6-bis(2-methylpropylsulfanyl)pyrimidine is sourced from PubChem (CID 25128806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).