C16H31N5 — CID 25128814
2-N,4-N,6-N-tris(2-methylpropyl)pyrimidine-2,4,6-triamine (PubChem CID 25128814) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(2-methylpropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(2-methylpropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 25128814 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 2-N,4-N,6-N-tris(2-methylpropyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)CNc1cc(NCC(C)C)nc(NCC(C)C)n1 |
| InChI | InChI=1S/C16H31N5/c1-11(2)8-17-14-7-15(18-9-12(3)4)21-16(20-14)19-10-13(5)6/h7,11-13H,8-10H2,1-6H3,(H3,17,18,19,20,21) |
| InChIKey | HVZSNANIMUMCPH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |