C16H28N2O3 — CID 25128815
2,4,6-tris(2-methylpropoxy)pyrimidine (PubChem CID 25128815) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,4,6-tris(2-methylpropoxy)pyrimidine.
| Compound Name | 2,4,6-tris(2-methylpropoxy)pyrimidine |
|---|---|
| PubChem CID | 25128815 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2,4,6-tris(2-methylpropoxy)pyrimidine |
| SMILES | CC(C)COc1cc(OCC(C)C)nc(OCC(C)C)n1 |
| InChI | InChI=1S/C16H28N2O3/c1-11(2)8-19-14-7-15(20-9-12(3)4)18-16(17-14)21-10-13(5)6/h7,11-13H,8-10H2,1-6H3 |
| InChIKey | LTPANPZIHUWIHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |