About 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine
4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine (PubChem CID 25128823) has the molecular formula C15H17N5
and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine |
| PubChem CID | 25128823 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc2c(c(N3CCNCC3)n1)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H17N5/c16-15-18-13-11-4-2-1-3-10(11)9-12(13)14(19-15)20-7-5-17-6-8-20/h1-4,17H,5-9H2,(H2,16,18,19) |
| InChIKey | UXPDQPNIBOHOSD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine?
The IUPAC name of 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine (CID 25128823) is 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine.
What is the SMILES notation for 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine?
The canonical SMILES for 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine is Nc1nc2c(c(N3CCNCC3)n1)Cc1ccccc1-2.
What is the InChIKey of 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine?
The InChIKey is UXPDQPNIBOHOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5/c16-15-18-13-11-4-2-1-3-10(11)9-12(13)14(19-15)20-7-5-17-6-8-20/h1-4,17H,5-9H2,(H2,16,18,19).
What are the key properties of 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine?
4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine has a molecular weight of 267.34 g/mol, XLogP of 1.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-5H-indeno[1,2-d]pyrimidin-2-amine is sourced from PubChem (CID 25128823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).