C21H30N4O2 — CID 25129301
1-(1-cyclooctylpiperidin-4-yl)-5H-pyrido[2,3-b][1,4]diazepine-2,4-dione (PubChem CID 25129301) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(1-cyclooctylpiperidin-4-yl)-5H-pyrido[2,3-b][1,4]diazepine-2,4-dione.
| Compound Name | 1-(1-cyclooctylpiperidin-4-yl)-5H-pyrido[2,3-b][1,4]diazepine-2,4-dione |
|---|---|
| PubChem CID | 25129301 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-(1-cyclooctylpiperidin-4-yl)-5H-pyrido[2,3-b][1,4]diazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(C2CCN(C3CCCCCCC3)CC2)c2cccnc2N1 |
| InChI | InChI=1S/C21H30N4O2/c26-19-15-20(27)25(18-9-6-12-22-21(18)23-19)17-10-13-24(14-11-17)16-7-4-2-1-3-5-8-16/h6,9,12,16-17H,1-5,7-8,10-11,13-15H2,(H,22,23,26) |
| InChIKey | NMGLMXRNNQARRH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|