C21H18FNO3 — CID 2512971
[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2512971) has the molecular formula C21H18FNO3 and a molecular weight of 351.38 g/mol. Its IUPAC name is [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2512971 |
| Molecular Formula | C21H18FNO3 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccccc1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H18FNO3/c1-2-23(19-13-7-9-15-8-3-4-10-16(15)19)20(24)14-26-21(25)17-11-5-6-12-18(17)22/h3-13H,2,14H2,1H3 |
| InChIKey | VGUGKHGKSTWCGR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |