C26H23ClN4O3 — CID 25129989
9-amino-5-(2-chloro-6-methyl-3-pyridinyl)-2-[(3,4-dimethoxyphenyl)methyl]-3H-pyrrolo[3,4-b]quinolin-1-one (PubChem CID 25129989) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is 9-amino-5-(2-chloro-6-methyl-3-pyridinyl)-2-[(3,4-dimethoxyphenyl)methyl]-3H-pyrrolo[3,4-b]quinolin-1-one.
| Compound Name | 9-amino-5-(2-chloro-6-methyl-3-pyridinyl)-2-[(3,4-dimethoxyphenyl)methyl]-3H-pyrrolo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 25129989 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 9-amino-5-(2-chloro-6-methyl-3-pyridinyl)-2-[(3,4-dimethoxyphenyl)methyl]-3H-pyrrolo[3,4-b]quinolin-1-one |
| SMILES | COc1ccc(CN2Cc3nc4c(-c5ccc(C)nc5Cl)cccc4c(N)c3C2=O)cc1OC |
| InChI | InChI=1S/C26H23ClN4O3/c1-14-7-9-17(25(27)29-14)16-5-4-6-18-23(28)22-19(30-24(16)18)13-31(26(22)32)12-15-8-10-20(33-2)21(11-15)34-3/h4-11H,12-13H2,1-3H3,(H2,28,30) |
| InChIKey | AWTCMLGQVKWSND-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|