C22H23F4N3O3 — CID 25130282
3-(4-fluorophenoxy)-1-[4-[2-[(E)-methoxyiminomethyl]-3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 25130282) has the molecular formula C22H23F4N3O3 and a molecular weight of 453.44 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)-1-[4-[2-[(E)-methoxyiminomethyl]-3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(4-fluorophenoxy)-1-[4-[2-[(E)-methoxyiminomethyl]-3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 25130282 |
| Molecular Formula | C22H23F4N3O3 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-(4-fluorophenoxy)-1-[4-[2-[(E)-methoxyiminomethyl]-3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | CO/N=C/c1c(N2CCN(C(=O)CCOc3ccc(F)cc3)CC2)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H23F4N3O3/c1-31-27-15-18-19(22(24,25)26)3-2-4-20(18)28-10-12-29(13-11-28)21(30)9-14-32-17-7-5-16(23)6-8-17/h2-8,15H,9-14H2,1H3/b27-15+ |
| InChIKey | QFEJAEGGBSFOBG-JFLMPSFJSA-N |
| XLogP | 3.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|