C30H33F3N2O2 — CID 25130315
4-(1-adamantylamino)-2-[2,6-di(propan-2-yl)phenyl]-5,6,7-trifluoroisoindole-1,3-dione (PubChem CID 25130315) has the molecular formula C30H33F3N2O2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 4-(1-adamantylamino)-2-[2,6-di(propan-2-yl)phenyl]-5,6,7-trifluoroisoindole-1,3-dione.
| Compound Name | 4-(1-adamantylamino)-2-[2,6-di(propan-2-yl)phenyl]-5,6,7-trifluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 25130315 |
| Molecular Formula | C30H33F3N2O2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 4-(1-adamantylamino)-2-[2,6-di(propan-2-yl)phenyl]-5,6,7-trifluoroisoindole-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2c(F)c(F)c(F)c(NC34CC5CC(CC(C5)C3)C4)c2C1=O |
| InChI | InChI=1S/C30H33F3N2O2/c1-14(2)19-6-5-7-20(15(3)4)27(19)35-28(36)21-22(29(35)37)26(25(33)24(32)23(21)31)34-30-11-16-8-17(12-30)10-18(9-16)13-30/h5-7,14-18,34H,8-13H2,1-4H3 |
| InChIKey | GUIGLCUTCPGOQG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|