About 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one
9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one (PubChem CID 25130339) has the molecular formula C21H20FN3O3
and a molecular weight of 381.41 g/mol. Its IUPAC name is 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one.
Molecular Properties
| Compound Name | 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one |
| PubChem CID | 25130339 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one |
| SMILES | CCN1Cc2nc3c(-c4cc(OC)ccc4OC)c(F)ccc3c(N)c2C1=O |
| InChI | InChI=1S/C21H20FN3O3/c1-4-25-10-15-18(21(25)26)19(23)12-6-7-14(22)17(20(12)24-15)13-9-11(27-2)5-8-16(13)28-3/h5-9H,4,10H2,1-3H3,(H2,23,24) |
| InChIKey | RFNXMSGJCRYTIU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one?
The IUPAC name of 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one (CID 25130339) is 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one.
What is the SMILES notation for 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one?
The canonical SMILES for 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one is CCN1Cc2nc3c(-c4cc(OC)ccc4OC)c(F)ccc3c(N)c2C1=O.
What is the InChIKey of 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one?
The InChIKey is RFNXMSGJCRYTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3O3/c1-4-25-10-15-18(21(25)26)19(23)12-6-7-14(22)17(20(12)24-15)13-9-11(27-2)5-8-16(13)28-3/h5-9H,4,10H2,1-3H3,(H2,23,24).
What are the key properties of 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one?
9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one has a molecular weight of 381.41 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-5-(2,5-dimethoxyphenyl)-2-ethyl-6-fluoro-3H-pyrrolo[3,4-b]quinolin-1-one is sourced from PubChem (CID 25130339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).