C34H57N5O3 — CID 25130374
(2R)-N-[(E,3R)-2,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohex-4-en-3-yl]-2-[[(2S)-3-(3,5-dimethylphenyl)-3-methyl-2-(methylamino)butanoyl]amino]-N,3,3-trimethylbutanamide (PubChem CID 25130374) has the molecular formula C34H57N5O3 and a molecular weight of 583.86 g/mol. Its IUPAC name is (2R)-N-[(E,3R)-2,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohex-4-en-3-yl]-2-[[(2S)-3-(3,5-dimethylphenyl)-3-methyl-2-(methylamino)butanoyl]amino]-N,3,3-trimethylbutanamide.
| Compound Name | (2R)-N-[(E,3R)-2,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohex-4-en-3-yl]-2-[[(2S)-3-(3,5-dimethylphenyl)-3-methyl-2-(methylamino)butanoyl]amino]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 25130374 |
| Molecular Formula | C34H57N5O3 |
| Molecular Weight | 583.86 g/mol |
| Exact Mass | 583.45 |
| IUPAC Name | (2R)-N-[(E,3R)-2,5-dimethyl-6-(4-methylpiperazin-1-yl)-6-oxohex-4-en-3-yl]-2-[[(2S)-3-(3,5-dimethylphenyl)-3-methyl-2-(methylamino)butanoyl]amino]-N,3,3-trimethylbutanamide |
| SMILES | CN[C@H](C(=O)N[C@@H](C(=O)N(C)[C@@H](/C=C(\C)C(=O)N1CCN(C)CC1)C(C)C)C(C)(C)C)C(C)(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C34H57N5O3/c1-22(2)27(21-25(5)31(41)39-16-14-37(12)15-17-39)38(13)32(42)29(33(6,7)8)36-30(40)28(35-11)34(9,10)26-19-23(3)18-24(4)20-26/h18-22,27-29,35H,14-17H2,1-13H3,(H,36,40)/b25-21+/t27-,28+,29-/m0/s1 |
| InChIKey | VSBFNXYGNMBYOF-CMCLKHNWSA-N |
| XLogP | 3.90 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|