C22H21ClN4O3 — CID 25130415
methyl 4-(4-acetylpiperazin-1-yl)-2-(2-chlorophenyl)quinazoline-7-carboxylate (PubChem CID 25130415) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is methyl 4-(4-acetylpiperazin-1-yl)-2-(2-chlorophenyl)quinazoline-7-carboxylate.
| Compound Name | methyl 4-(4-acetylpiperazin-1-yl)-2-(2-chlorophenyl)quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 25130415 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | methyl 4-(4-acetylpiperazin-1-yl)-2-(2-chlorophenyl)quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(N3CCN(C(C)=O)CC3)nc(-c3ccccc3Cl)nc2c1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-14(28)26-9-11-27(12-10-26)21-17-8-7-15(22(29)30-2)13-19(17)24-20(25-21)16-5-3-4-6-18(16)23/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | VBTKVZBHHLIKPK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |