About N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide
N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide (PubChem CID 25130556) has the molecular formula C19H27Cl2N3O2
and a molecular weight of 400.35 g/mol. Its IUPAC name is N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| PubChem CID | 25130556 |
| Molecular Formula | C19H27Cl2N3O2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| SMILES | CC(C)(C)NC(=O)CN1CCC(CNC(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H27Cl2N3O2/c1-19(2,3)23-17(25)12-24-6-4-13(5-7-24)11-22-18(26)14-8-15(20)10-16(21)9-14/h8-10,13H,4-7,11-12H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | JVHZYELJAMTTHN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The IUPAC name of N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide (CID 25130556) is N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide.
What is the SMILES notation for N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The canonical SMILES for N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide is CC(C)(C)NC(=O)CN1CCC(CNC(=O)c2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The InChIKey is JVHZYELJAMTTHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27Cl2N3O2/c1-19(2,3)23-17(25)12-24-6-4-13(5-7-24)11-22-18(26)14-8-15(20)10-16(21)9-14/h8-10,13H,4-7,11-12H2,1-3H3,(H,22,26)(H,23,25).
What are the key properties of N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide has a molecular weight of 400.35 g/mol, XLogP of 3.35, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide is sourced from PubChem (CID 25130556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).